About (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate
(4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate (PubChem CID 135271655) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate.
Molecular Properties
| Compound Name | (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate |
| PubChem CID | 135271655 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate |
| SMILES | COc1cc(C=O)ccc1OC(=O)[C@H](C)OC |
| InChI | InChI=1S/C12H14O5/c1-8(15-2)12(14)17-10-5-4-9(7-13)6-11(10)16-3/h4-8H,1-3H3/t8-/m0/s1 |
| InChIKey | RTENMBFGRGFWLR-QMMMGPOBSA-N |
| XLogP | 1.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate?
The IUPAC name of (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate (CID 135271655) is (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate.
What is the SMILES notation for (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate?
The canonical SMILES for (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate is COc1cc(C=O)ccc1OC(=O)[C@H](C)OC.
What is the InChIKey of (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate?
The InChIKey is RTENMBFGRGFWLR-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H14O5/c1-8(15-2)12(14)17-10-5-4-9(7-13)6-11(10)16-3/h4-8H,1-3H3/t8-/m0/s1.
What are the key properties of (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate?
(4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate has a molecular weight of 238.24 g/mol, XLogP of 1.45, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formyl-2-methoxyphenyl) (2S)-2-methoxypropanoate is sourced from PubChem (CID 135271655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).