About (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate
(4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate (PubChem CID 163765604) has the molecular formula C14H18O5
and a molecular weight of 266.29 g/mol. Its IUPAC name is (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate.
Molecular Properties
| Compound Name | (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate |
| PubChem CID | 163765604 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate |
| SMILES | COc1cc(C=O)ccc1OC(=O)CCCC(C)O |
| InChI | InChI=1S/C14H18O5/c1-10(16)4-3-5-14(17)19-12-7-6-11(9-15)8-13(12)18-2/h6-10,16H,3-5H2,1-2H3 |
| InChIKey | MBZSZJNIVVUIPA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate?
The IUPAC name of (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate (CID 163765604) is (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate.
What is the SMILES notation for (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate?
The canonical SMILES for (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate is COc1cc(C=O)ccc1OC(=O)CCCC(C)O.
What is the InChIKey of (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate?
The InChIKey is MBZSZJNIVVUIPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5/c1-10(16)4-3-5-14(17)19-12-7-6-11(9-15)8-13(12)18-2/h6-10,16H,3-5H2,1-2H3.
What are the key properties of (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate?
(4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate has a molecular weight of 266.29 g/mol, XLogP of 1.96, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formyl-2-methoxyphenyl) 5-hydroxyhexanoate is sourced from PubChem (CID 163765604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).