C15H12O7 — CID 175007012
(4-formyl-2-methoxyphenyl) 3,4,5-trihydroxybenzoate (PubChem CID 175007012) has the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. Its IUPAC name is (4-formyl-2-methoxyphenyl) 3,4,5-trihydroxybenzoate.
| Compound Name | (4-formyl-2-methoxyphenyl) 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 175007012 |
| Molecular Formula | C15H12O7 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (4-formyl-2-methoxyphenyl) 3,4,5-trihydroxybenzoate |
| SMILES | COc1cc(C=O)ccc1OC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C15H12O7/c1-21-13-4-8(7-16)2-3-12(13)22-15(20)9-5-10(17)14(19)11(18)6-9/h2-7,17-19H,1H3 |
| InChIKey | RWFBIAAEGGQTAF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|