C17H16O8 — CID 89045538
[2-methoxy-4-(2-methoxy-2-oxoethyl)phenyl] 3,4,5-trihydroxybenzoate (PubChem CID 89045538) has the molecular formula C17H16O8 and a molecular weight of 348.31 g/mol. Its IUPAC name is [2-methoxy-4-(2-methoxy-2-oxoethyl)phenyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-methoxy-4-(2-methoxy-2-oxoethyl)phenyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 89045538 |
| Molecular Formula | C17H16O8 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [2-methoxy-4-(2-methoxy-2-oxoethyl)phenyl] 3,4,5-trihydroxybenzoate |
| SMILES | COC(=O)Cc1ccc(OC(=O)c2cc(O)c(O)c(O)c2)c(OC)c1 |
| InChI | InChI=1S/C17H16O8/c1-23-14-5-9(6-15(20)24-2)3-4-13(14)25-17(22)10-7-11(18)16(21)12(19)8-10/h3-5,7-8,18-19,21H,6H2,1-2H3 |
| InChIKey | UPXHZNXPMXVOPY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|