C22H24O8 — CID 101215077
[2-methoxy-4-[(E)-3-(2-methylbutoxy)-3-oxoprop-1-enyl]phenyl] 3,4,5-trihydroxybenzoate (PubChem CID 101215077) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(2-methylbutoxy)-3-oxoprop-1-enyl]phenyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-methoxy-4-[(E)-3-(2-methylbutoxy)-3-oxoprop-1-enyl]phenyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 101215077 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(2-methylbutoxy)-3-oxoprop-1-enyl]phenyl] 3,4,5-trihydroxybenzoate |
| SMILES | CCC(C)COC(=O)/C=C/c1ccc(OC(=O)c2cc(O)c(O)c(O)c2)c(OC)c1 |
| InChI | InChI=1S/C22H24O8/c1-4-13(2)12-29-20(25)8-6-14-5-7-18(19(9-14)28-3)30-22(27)15-10-16(23)21(26)17(24)11-15/h5-11,13,23-24,26H,4,12H2,1-3H3/b8-6+ |
| InChIKey | VVTVIKQTYPOFIH-SOFGYWHQSA-N |
| XLogP | 3.63 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|