C15H18O5 — CID 174896594
2-methylpropyl 3-(4-formyloxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 174896594) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-methylpropyl 3-(4-formyloxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | 2-methylpropyl 3-(4-formyloxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 174896594 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-methylpropyl 3-(4-formyloxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OCC(C)C)ccc1OC=O |
| InChI | InChI=1S/C15H18O5/c1-11(2)9-19-15(17)7-5-12-4-6-13(20-10-16)14(8-12)18-3/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | VNXGTCCPQPQVGN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|