C22H23NO4 — CID 8887629
(2-cyanophenyl)methyl (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate (PubChem CID 8887629) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (2-cyanophenyl)methyl (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate.
| Compound Name | (2-cyanophenyl)methyl (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8887629 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (2-cyanophenyl)methyl (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2ccccc2C#N)ccc1OCC(C)C |
| InChI | InChI=1S/C22H23NO4/c1-16(2)14-26-20-10-8-17(12-21(20)25-3)9-11-22(24)27-15-19-7-5-4-6-18(19)13-23/h4-12,16H,14-15H2,1-3H3/b11-9+ |
| InChIKey | BGEULNCUHATKLS-PKNBQFBNSA-N |
| XLogP | 4.36 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|