C13H15NO5 — CID 6163287
(2-amino-2-oxoethyl) (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 6163287) has the molecular formula C13H15NO5 and a molecular weight of 265.27 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (2-amino-2-oxoethyl) (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6163287 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (2-amino-2-oxoethyl) (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(N)=O)cc1OC |
| InChI | InChI=1S/C13H15NO5/c1-17-10-5-3-9(7-11(10)18-2)4-6-13(16)19-8-12(14)15/h3-7H,8H2,1-2H3,(H2,14,15)/b6-4+ |
| InChIKey | VYTBESOGXYTHHC-GQCTYLIASA-N |
| XLogP | 0.75 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|