About 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate
2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate (PubChem CID 5352628) has the molecular formula C17H24O4Si
and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate |
| PubChem CID | 5352628 |
| Molecular Formula | C17H24O4Si |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate |
| SMILES | C=C(C)COC(=O)/C=C/c1ccc(OC)c(O[Si](C)(C)C)c1 |
| InChI | InChI=1S/C17H24O4Si/c1-13(2)12-20-17(18)10-8-14-7-9-15(19-3)16(11-14)21-22(4,5)6/h7-11H,1,12H2,2-6H3/b10-8+ |
| InChIKey | GRUNAUVVSMPNLW-CSKARUKUSA-N |
| XLogP | 4.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate?
The IUPAC name of 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate (CID 5352628) is 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate.
What is the SMILES notation for 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate?
The canonical SMILES for 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate is C=C(C)COC(=O)/C=C/c1ccc(OC)c(O[Si](C)(C)C)c1.
What is the InChIKey of 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate?
The InChIKey is GRUNAUVVSMPNLW-CSKARUKUSA-N. The full InChI is InChI=1S/C17H24O4Si/c1-13(2)12-20-17(18)10-8-14-7-9-15(19-3)16(11-14)21-22(4,5)6/h7-11H,1,12H2,2-6H3/b10-8+.
What are the key properties of 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate?
2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate has a molecular weight of 320.46 g/mol, XLogP of 4.04, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enyl (E)-3-(4-methoxy-3-trimethylsilyloxyphenyl)prop-2-enoate is sourced from PubChem (CID 5352628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).