C21H23FO5 — CID 7726363
(5-fluoro-2-methoxyphenyl)methyl (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate (PubChem CID 7726363) has the molecular formula C21H23FO5 and a molecular weight of 374.41 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)methyl (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate.
| Compound Name | (5-fluoro-2-methoxyphenyl)methyl (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7726363 |
| Molecular Formula | C21H23FO5 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)methyl (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(F)cc1COC(=O)/C=C/c1ccc(OC(C)C)c(OC)c1 |
| InChI | InChI=1S/C21H23FO5/c1-14(2)27-19-8-5-15(11-20(19)25-4)6-10-21(23)26-13-16-12-17(22)7-9-18(16)24-3/h5-12,14H,13H2,1-4H3/b10-6+ |
| InChIKey | UPWYWRDZTVUOJW-UXBLZVDNSA-N |
| XLogP | 4.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|