C20H22O7 — CID 7726518
methyl 5-[[(E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoyl]oxymethyl]furan-2-carboxylate (PubChem CID 7726518) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is methyl 5-[[(E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoyl]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoyl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 7726518 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | methyl 5-[[(E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoyl]oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)/C=C/c2ccc(OC(C)C)c(OC)c2)o1 |
| InChI | InChI=1S/C20H22O7/c1-13(2)26-16-8-5-14(11-18(16)23-3)6-10-19(21)25-12-15-7-9-17(27-15)20(22)24-4/h5-11,13H,12H2,1-4H3/b10-6+ |
| InChIKey | OZRCHPQPKJYOQX-UXBLZVDNSA-N |
| XLogP | 3.62 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|