C19H20O6S — CID 169458360
methyl 5-[[4-(3-acetylsulfanylprop-1-enyl)-2-methoxyphenoxy]methyl]furan-2-carboxylate (PubChem CID 169458360) has the molecular formula C19H20O6S and a molecular weight of 376.43 g/mol. Its IUPAC name is methyl 5-[[4-(3-acetylsulfanylprop-1-enyl)-2-methoxyphenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-(3-acetylsulfanylprop-1-enyl)-2-methoxyphenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 169458360 |
| Molecular Formula | C19H20O6S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | methyl 5-[[4-(3-acetylsulfanylprop-1-enyl)-2-methoxyphenoxy]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COc2ccc(C=CCSC(C)=O)cc2OC)o1 |
| InChI | InChI=1S/C19H20O6S/c1-13(20)26-10-4-5-14-6-8-16(18(11-14)22-2)24-12-15-7-9-17(25-15)19(21)23-3/h4-9,11H,10,12H2,1-3H3 |
| InChIKey | WIOUOOVHHQCINT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|