C16H14F2O7 — CID 2606973
methyl 5-[[4-(difluoromethoxy)-3-methoxybenzoyl]oxymethyl]furan-2-carboxylate (PubChem CID 2606973) has the molecular formula C16H14F2O7 and a molecular weight of 356.28 g/mol. Its IUPAC name is methyl 5-[[4-(difluoromethoxy)-3-methoxybenzoyl]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-(difluoromethoxy)-3-methoxybenzoyl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 2606973 |
| Molecular Formula | C16H14F2O7 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | methyl 5-[[4-(difluoromethoxy)-3-methoxybenzoyl]oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)c2ccc(OC(F)F)c(OC)c2)o1 |
| InChI | InChI=1S/C16H14F2O7/c1-21-13-7-9(3-5-11(13)25-16(17)18)14(19)23-8-10-4-6-12(24-10)15(20)22-2/h3-7,16H,8H2,1-2H3 |
| InChIKey | PJTWYJKQDXTRTD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |