C16H15F2NO6 — CID 7665331
methyl 5-[[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxymethyl]furan-2-carboxylate (PubChem CID 7665331) has the molecular formula C16H15F2NO6 and a molecular weight of 355.29 g/mol. Its IUPAC name is methyl 5-[[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 7665331 |
| Molecular Formula | C16H15F2NO6 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | methyl 5-[[(Z)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CO/N=C\c2ccc(OC(F)F)c(OC)c2)o1 |
| InChI | InChI=1S/C16H15F2NO6/c1-21-14-7-10(3-5-12(14)25-16(17)18)8-19-23-9-11-4-6-13(24-11)15(20)22-2/h3-8,16H,9H2,1-2H3/b19-8- |
| InChIKey | HYJGXLNCQPGMKO-UWVJOHFNSA-N |
| XLogP | 3.23 |
| TPSA | 79.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|