C13H17F2NO4 — CID 75535927
(E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-methoxypropoxy)methanimine (PubChem CID 75535927) has the molecular formula C13H17F2NO4 and a molecular weight of 289.28 g/mol. Its IUPAC name is (E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-methoxypropoxy)methanimine.
| Compound Name | (E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-methoxypropoxy)methanimine |
|---|---|
| PubChem CID | 75535927 |
| Molecular Formula | C13H17F2NO4 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-methoxypropoxy)methanimine |
| SMILES | COCCCO/N=C/c1ccc(OC(F)F)c(OC)c1 |
| InChI | InChI=1S/C13H17F2NO4/c1-17-6-3-7-19-16-9-10-4-5-11(20-13(14)15)12(8-10)18-2/h4-5,8-9,13H,3,6-7H2,1-2H3/b16-9+ |
| InChIKey | DGBXZNLLEJUANG-CXUHLZMHSA-N |
| XLogP | 2.68 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|