C16H14ClF2NO3 — CID 76856045
N-[(3-chlorophenyl)methoxy]-1-[4-(difluoromethoxy)-3-methoxyphenyl]methanimine (PubChem CID 76856045) has the molecular formula C16H14ClF2NO3 and a molecular weight of 341.74 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methoxy]-1-[4-(difluoromethoxy)-3-methoxyphenyl]methanimine.
| Compound Name | N-[(3-chlorophenyl)methoxy]-1-[4-(difluoromethoxy)-3-methoxyphenyl]methanimine |
|---|---|
| PubChem CID | 76856045 |
| Molecular Formula | C16H14ClF2NO3 |
| Molecular Weight | 341.74 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-[(3-chlorophenyl)methoxy]-1-[4-(difluoromethoxy)-3-methoxyphenyl]methanimine |
| SMILES | COc1cc(C=NOCc2cccc(Cl)c2)ccc1OC(F)F |
| InChI | InChI=1S/C16H14ClF2NO3/c1-21-15-8-11(5-6-14(15)23-16(18)19)9-20-22-10-12-3-2-4-13(17)7-12/h2-9,16H,10H2,1H3 |
| InChIKey | FOZQAWWSUGTYKY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.74 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|