C17H16ClF2NO4 — CID 75394681
(E)-N-[(3-chloro-4-methoxyphenyl)methoxy]-1-[4-(difluoromethoxy)-3-methoxyphenyl]methanimine (PubChem CID 75394681) has the molecular formula C17H16ClF2NO4 and a molecular weight of 371.77 g/mol. Its IUPAC name is (E)-N-[(3-chloro-4-methoxyphenyl)methoxy]-1-[4-(difluoromethoxy)-3-methoxyphenyl]methanimine.
| Compound Name | (E)-N-[(3-chloro-4-methoxyphenyl)methoxy]-1-[4-(difluoromethoxy)-3-methoxyphenyl]methanimine |
|---|---|
| PubChem CID | 75394681 |
| Molecular Formula | C17H16ClF2NO4 |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | (E)-N-[(3-chloro-4-methoxyphenyl)methoxy]-1-[4-(difluoromethoxy)-3-methoxyphenyl]methanimine |
| SMILES | COc1ccc(CO/N=C/c2ccc(OC(F)F)c(OC)c2)cc1Cl |
| InChI | InChI=1S/C17H16ClF2NO4/c1-22-14-5-4-12(7-13(14)18)10-24-21-9-11-3-6-15(25-17(19)20)16(8-11)23-2/h3-9,17H,10H2,1-2H3/b21-9+ |
| InChIKey | NZZJHXVQRMIHCI-ZVBGSRNCSA-N |
| XLogP | 4.51 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|