C17H16ClNO5 — CID 42923821
(E)-N-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]-1-(3,4-dimethoxyphenyl)methanimine (PubChem CID 42923821) has the molecular formula C17H16ClNO5 and a molecular weight of 349.77 g/mol. Its IUPAC name is (E)-N-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]-1-(3,4-dimethoxyphenyl)methanimine.
| Compound Name | (E)-N-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]-1-(3,4-dimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 42923821 |
| Molecular Formula | C17H16ClNO5 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (E)-N-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]-1-(3,4-dimethoxyphenyl)methanimine |
| SMILES | COc1ccc(/C=N/OCc2cc(Cl)c3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C17H16ClNO5/c1-20-14-4-3-11(6-15(14)21-2)8-19-24-9-12-5-13(18)17-16(7-12)22-10-23-17/h3-8H,9-10H2,1-2H3/b19-8+ |
| InChIKey | CCOMESKOXYQFHJ-UFWORHAWSA-N |
| XLogP | 3.64 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|