C20H18Cl2O6 — CID 18273767
(7-chloro-1,3-benzodioxol-5-yl)methyl (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 18273767) has the molecular formula C20H18Cl2O6 and a molecular weight of 425.26 g/mol. Its IUPAC name is (7-chloro-1,3-benzodioxol-5-yl)methyl (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | (7-chloro-1,3-benzodioxol-5-yl)methyl (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18273767 |
| Molecular Formula | C20H18Cl2O6 |
| Molecular Weight | 425.26 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | (7-chloro-1,3-benzodioxol-5-yl)methyl (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCc2cc(Cl)c3c(c2)OCO3)cc(Cl)c1OC |
| InChI | InChI=1S/C20H18Cl2O6/c1-3-25-16-8-12(6-14(21)19(16)24-2)4-5-18(23)26-10-13-7-15(22)20-17(9-13)27-11-28-20/h4-9H,3,10-11H2,1-2H3/b5-4+ |
| InChIKey | UYOPUQZQVNADPM-SNAWJCMRSA-N |
| XLogP | 4.89 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|