C21H19ClO6 — CID 8661007
(5-acetyl-2-ethoxyphenyl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8661007) has the molecular formula C21H19ClO6 and a molecular weight of 402.83 g/mol. Its IUPAC name is (5-acetyl-2-ethoxyphenyl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | (5-acetyl-2-ethoxyphenyl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8661007 |
| Molecular Formula | C21H19ClO6 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (5-acetyl-2-ethoxyphenyl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | CCOc1ccc(C(C)=O)cc1COC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C21H19ClO6/c1-3-25-18-6-5-15(13(2)23)10-16(18)11-26-20(24)7-4-14-8-17(22)21-19(9-14)27-12-28-21/h4-10H,3,11-12H2,1-2H3/b7-4+ |
| InChIKey | AEPBMHPALURNLG-QPJJXVBHSA-N |
| XLogP | 4.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|