C15H15ClO5 — CID 72684841
(3-methyloxetan-3-yl)methyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 72684841) has the molecular formula C15H15ClO5 and a molecular weight of 310.73 g/mol. Its IUPAC name is (3-methyloxetan-3-yl)methyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | (3-methyloxetan-3-yl)methyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 72684841 |
| Molecular Formula | C15H15ClO5 |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (3-methyloxetan-3-yl)methyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | CC1(COC(=O)C=Cc2cc(Cl)c3c(c2)OCO3)COC1 |
| InChI | InChI=1S/C15H15ClO5/c1-15(6-18-7-15)8-19-13(17)3-2-10-4-11(16)14-12(5-10)20-9-21-14/h2-5H,6-9H2,1H3 |
| InChIKey | UGACNYRQKYYAOF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|