C18H13ClO5 — CID 8660952
phenacyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8660952) has the molecular formula C18H13ClO5 and a molecular weight of 344.75 g/mol. Its IUPAC name is phenacyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | phenacyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8660952 |
| Molecular Formula | C18H13ClO5 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | phenacyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H13ClO5/c19-14-8-12(9-16-18(14)24-11-23-16)6-7-17(21)22-10-15(20)13-4-2-1-3-5-13/h1-9H,10-11H2/b7-6+ |
| InChIKey | QIHZNJOQTRJFHL-VOTSOKGWSA-N |
| XLogP | 3.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|