C21H16ClNO6 — CID 8674005
[2-oxo-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8674005) has the molecular formula C21H16ClNO6 and a molecular weight of 413.81 g/mol. Its IUPAC name is [2-oxo-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8674005 |
| Molecular Formula | C21H16ClNO6 |
| Molecular Weight | 413.81 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | [2-oxo-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C1CCc2cc(C(=O)COC(=O)/C=C/c3cc(Cl)c4c(c3)OCO4)ccc2N1 |
| InChI | InChI=1S/C21H16ClNO6/c22-15-7-12(8-18-21(15)29-11-28-18)1-6-20(26)27-10-17(24)14-2-4-16-13(9-14)3-5-19(25)23-16/h1-2,4,6-9H,3,5,10-11H2,(H,23,25)/b6-1+ |
| InChIKey | KKOWEVLQBHABRD-LZCJLJQNSA-N |
| XLogP | 3.39 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|