C22H22ClNO5 — CID 8660917
[2-(2,6-diethylanilino)-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8660917) has the molecular formula C22H22ClNO5 and a molecular weight of 415.87 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8660917 |
| Molecular Formula | C22H22ClNO5 |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C22H22ClNO5/c1-3-15-6-5-7-16(4-2)21(15)24-19(25)12-27-20(26)9-8-14-10-17(23)22-18(11-14)28-13-29-22/h5-11H,3-4,12-13H2,1-2H3,(H,24,25)/b9-8+ |
| InChIKey | RRWGEWXRRPTYGD-CMDGGOBGSA-N |
| XLogP | 4.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|