C20H14ClNO6 — CID 8673961
[2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8673961) has the molecular formula C20H14ClNO6 and a molecular weight of 399.79 g/mol. Its IUPAC name is [2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8673961 |
| Molecular Formula | C20H14ClNO6 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | [2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C1Cc2cc(C(=O)COC(=O)/C=C/c3cc(Cl)c4c(c3)OCO4)ccc2N1 |
| InChI | InChI=1S/C20H14ClNO6/c21-14-5-11(6-17-20(14)28-10-27-17)1-4-19(25)26-9-16(23)12-2-3-15-13(7-12)8-18(24)22-15/h1-7H,8-10H2,(H,22,24)/b4-1+ |
| InChIKey | ZSTPIFKEAJKOJC-DAFODLJHSA-N |
| XLogP | 3.00 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|