C21H14ClNO4S — CID 8835401
[2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 8835401) has the molecular formula C21H14ClNO4S and a molecular weight of 411.87 g/mol. Its IUPAC name is [2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8835401 |
| Molecular Formula | C21H14ClNO4S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | [2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | O=C1Cc2cc(C(=O)COC(=O)/C=C/c3sc4ccccc4c3Cl)ccc2N1 |
| InChI | InChI=1S/C21H14ClNO4S/c22-21-14-3-1-2-4-17(14)28-18(21)7-8-20(26)27-11-16(24)12-5-6-15-13(9-12)10-19(25)23-15/h1-9H,10-11H2,(H,23,25)/b8-7+ |
| InChIKey | FLFPCYIPJHKQMT-BQYQJAHWSA-N |
| XLogP | 4.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|