C18H12Cl2N2O3S — CID 7721460
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 7721460) has the molecular formula C18H12Cl2N2O3S and a molecular weight of 407.28 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7721460 |
| Molecular Formula | C18H12Cl2N2O3S |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1sc2ccccc2c1Cl)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H12Cl2N2O3S/c19-11-5-7-15(21-9-11)22-16(23)10-25-17(24)8-6-14-18(20)12-3-1-2-4-13(12)26-14/h1-9H,10H2,(H,21,22,23)/b8-6+ |
| InChIKey | KHLDHNGXYWCLRM-SOFGYWHQSA-N |
| XLogP | 4.80 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|