C18H13ClN2O4S2 — CID 27748301
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 27748301) has the molecular formula C18H13ClN2O4S2 and a molecular weight of 420.90 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 27748301 |
| Molecular Formula | C18H13ClN2O4S2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)/C=C/c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C18H13ClN2O4S2/c19-16-10-3-1-2-4-12(10)27-13(16)5-6-15(23)25-9-14(22)21-18-11(17(20)24)7-8-26-18/h1-8H,9H2,(H2,20,24)(H,21,22)/b6-5+ |
| InChIKey | OBUMPJODLZTKSJ-AATRIKPKSA-N |
| XLogP | 3.91 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|