C16H13ClN2O4S — CID 2527195
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 2527195) has the molecular formula C16H13ClN2O4S and a molecular weight of 364.81 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2527195 |
| Molecular Formula | C16H13ClN2O4S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN2O4S/c17-11-4-1-10(2-5-11)3-6-14(21)23-9-13(20)19-16-12(15(18)22)7-8-24-16/h1-8H,9H2,(H2,18,22)(H,19,20)/b6-3+ |
| InChIKey | SDBFODXFVHTRCG-ZZXKWVIFSA-N |
| XLogP | 2.70 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|