C17H14N2O6S — CID 3439641
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 3439641) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3439641 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)C=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14N2O6S/c18-16(22)11-5-6-26-17(11)19-14(20)8-23-15(21)4-2-10-1-3-12-13(7-10)25-9-24-12/h1-7H,8-9H2,(H2,18,22)(H,19,20) |
| InChIKey | LIZUBUCEMJZDLL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|