C18H14N2O5S — CID 7622977
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate (PubChem CID 7622977) has the molecular formula C18H14N2O5S and a molecular weight of 370.39 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7622977 |
| Molecular Formula | C18H14N2O5S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)/C=C/c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H14N2O5S/c19-10-13-5-8-26-18(13)20-16(21)11-25-17(22)4-2-12-1-3-14-15(9-12)24-7-6-23-14/h1-5,8-9H,6-7,11H2,(H,20,21)/b4-2+ |
| InChIKey | OIMSITXHHHQNGW-DUXPYHPUSA-N |
| XLogP | 2.59 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|