C16H10Cl2N2O3S — CID 7997092
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 7997092) has the molecular formula C16H10Cl2N2O3S and a molecular weight of 381.24 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7997092 |
| Molecular Formula | C16H10Cl2N2O3S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H10Cl2N2O3S/c17-12-3-1-10(7-13(12)18)2-4-15(22)23-9-14(21)20-16-11(8-19)5-6-24-16/h1-7H,9H2,(H,20,21)/b4-2+ |
| InChIKey | YJLBNVGAGLJRFZ-DUXPYHPUSA-N |
| XLogP | 4.12 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|