C18H14Cl3NO3 — CID 1191653
[2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 1191653) has the molecular formula C18H14Cl3NO3 and a molecular weight of 398.67 g/mol. Its IUPAC name is [2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 1191653 |
| Molecular Formula | C18H14Cl3NO3 |
| Molecular Weight | 398.67 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | Cc1c(Cl)cccc1NC(=O)COC(=O)C=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl3NO3/c1-11-13(19)3-2-4-16(11)22-17(23)10-25-18(24)8-6-12-5-7-14(20)15(21)9-12/h2-9H,10H2,1H3,(H,22,23) |
| InChIKey | BVHLNVLBHRFOEH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|