C22H22Cl2N2O6 — CID 28597676
[2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 28597676) has the molecular formula C22H22Cl2N2O6 and a molecular weight of 481.33 g/mol. Its IUPAC name is [2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 28597676 |
| Molecular Formula | C22H22Cl2N2O6 |
| Molecular Weight | 481.33 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | [2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NCC(=O)Nc2cccc(Cl)c2C)cc(Cl)c1OC |
| InChI | InChI=1S/C22H22Cl2N2O6/c1-13-15(23)5-4-6-17(13)26-19(27)11-25-20(28)12-32-21(29)8-7-14-9-16(24)22(31-3)18(10-14)30-2/h4-10H,11-12H2,1-3H3,(H,25,28)(H,26,27)/b8-7+ |
| InChIKey | GYVSKDIOARXHRT-BQYQJAHWSA-N |
| XLogP | 3.63 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|