C17H22ClNO5 — CID 2492729
[2-(2-methylpropylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 2492729) has the molecular formula C17H22ClNO5 and a molecular weight of 355.82 g/mol. Its IUPAC name is [2-(2-methylpropylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2-methylpropylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2492729 |
| Molecular Formula | C17H22ClNO5 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [2-(2-methylpropylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NCC(C)C)cc(Cl)c1OC |
| InChI | InChI=1S/C17H22ClNO5/c1-11(2)9-19-15(20)10-24-16(21)6-5-12-7-13(18)17(23-4)14(8-12)22-3/h5-8,11H,9-10H2,1-4H3,(H,19,20)/b6-5+ |
| InChIKey | MDYZBHFSSUCMIG-AATRIKPKSA-N |
| XLogP | 2.69 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|