C18H22ClNO6 — CID 7757701
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 7757701) has the molecular formula C18H22ClNO6 and a molecular weight of 383.83 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7757701 |
| Molecular Formula | C18H22ClNO6 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NC[C@@H]2CCCO2)cc(Cl)c1OC |
| InChI | InChI=1S/C18H22ClNO6/c1-23-15-9-12(8-14(19)18(15)24-2)5-6-17(22)26-11-16(21)20-10-13-4-3-7-25-13/h5-6,8-9,13H,3-4,7,10-11H2,1-2H3,(H,20,21)/b6-5+/t13-/m0/s1 |
| InChIKey | XZRQUZVBTCNNFE-GFUIURDCSA-N |
| XLogP | 2.21 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|