C16H18FNO4 — CID 8021390
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 8021390) has the molecular formula C16H18FNO4 and a molecular weight of 307.32 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8021390 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc(F)c1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C16H18FNO4/c17-13-4-1-3-12(9-13)6-7-16(20)22-11-15(19)18-10-14-5-2-8-21-14/h1,3-4,6-7,9,14H,2,5,8,10-11H2,(H,18,19)/b7-6+/t14-/m1/s1 |
| InChIKey | GPBCFBQZYGUHMO-PSKZRQQASA-N |
| XLogP | 1.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|