C14H16ClNO4 — CID 2362816
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-chlorobenzoate (PubChem CID 2362816) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-chlorobenzoate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 2362816 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Cl)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H16ClNO4/c15-12-6-2-1-5-11(12)14(18)20-9-13(17)16-8-10-4-3-7-19-10/h1-2,5-6,10H,3-4,7-9H2,(H,16,17)/t10-/m0/s1 |
| InChIKey | VYKAQAZALUZCJN-JTQLQIEISA-N |
| XLogP | 1.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |