C16H16ClNO4S — CID 2391052
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 2391052) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 2391052 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1sc2ccccc2c1Cl)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C16H16ClNO4S/c17-14-11-5-1-2-6-12(11)23-15(14)16(20)22-9-13(19)18-8-10-4-3-7-21-10/h1-2,5-6,10H,3-4,7-9H2,(H,18,19)/t10-/m1/s1 |
| InChIKey | WJLJUXFKIRPGLR-SNVBAGLBSA-N |
| XLogP | 3.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |