C21H23NO4 — CID 16523743
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2,2-diphenylacetate (PubChem CID 16523743) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2,2-diphenylacetate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 16523743 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2,2-diphenylacetate |
| SMILES | O=C(COC(=O)C(c1ccccc1)c1ccccc1)NCC1CCCO1 |
| InChI | InChI=1S/C21H23NO4/c23-19(22-14-18-12-7-13-25-18)15-26-21(24)20(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,18,20H,7,12-15H2,(H,22,23) |
| InChIKey | OBMGZSHHGXBMIK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |