C21H21NO5 — CID 2621831
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-benzoylbenzoate (PubChem CID 2621831) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-benzoylbenzoate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 2621831 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-benzoylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1C(=O)c1ccccc1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C21H21NO5/c23-19(22-13-16-9-6-12-26-16)14-27-21(25)18-11-5-4-10-17(18)20(24)15-7-2-1-3-8-15/h1-5,7-8,10-11,16H,6,9,12-14H2,(H,22,23)/t16-/m0/s1 |
| InChIKey | OJPPSVMDKKQSLF-INIZCTEOSA-N |
| XLogP | 2.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |