C23H22N2O4 — CID 2389461
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-phenylquinoline-4-carboxylate (PubChem CID 2389461) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-phenylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2389461 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-phenylquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccccc2)nc2ccccc12)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C23H22N2O4/c26-22(24-14-17-9-6-12-28-17)15-29-23(27)19-13-21(16-7-2-1-3-8-16)25-20-11-5-4-10-18(19)20/h1-5,7-8,10-11,13,17H,6,9,12,14-15H2,(H,24,26)/t17-/m1/s1 |
| InChIKey | PQLTVWAQWONOIH-QGZVFWFLSA-N |
| XLogP | 3.35 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |