C23H21BrN2O4 — CID 2129314
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-bromophenyl)quinoline-4-carboxylate (PubChem CID 2129314) has the molecular formula C23H21BrN2O4 and a molecular weight of 469.34 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-bromophenyl)quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-bromophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2129314 |
| Molecular Formula | C23H21BrN2O4 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(4-bromophenyl)quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(Br)cc2)nc2ccccc12)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C23H21BrN2O4/c24-16-9-7-15(8-10-16)21-12-19(18-5-1-2-6-20(18)26-21)23(28)30-14-22(27)25-13-17-4-3-11-29-17/h1-2,5-10,12,17H,3-4,11,13-14H2,(H,25,27)/t17-/m1/s1 |
| InChIKey | IYHUUVGUMVTHLP-QGZVFWFLSA-N |
| XLogP | 4.12 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |