C25H25BrN2O3 — CID 2364327
[2-(cyclohexylmethylamino)-2-oxoethyl] 2-(3-bromophenyl)quinoline-4-carboxylate (PubChem CID 2364327) has the molecular formula C25H25BrN2O3 and a molecular weight of 481.39 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 2-(3-bromophenyl)quinoline-4-carboxylate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 2-(3-bromophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2364327 |
| Molecular Formula | C25H25BrN2O3 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 2-(3-bromophenyl)quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2cccc(Br)c2)nc2ccccc12)NCC1CCCCC1 |
| InChI | InChI=1S/C25H25BrN2O3/c26-19-10-6-9-18(13-19)23-14-21(20-11-4-5-12-22(20)28-23)25(30)31-16-24(29)27-15-17-7-2-1-3-8-17/h4-6,9-14,17H,1-3,7-8,15-16H2,(H,27,29) |
| InChIKey | KMWSPYPTFSSOGY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |