C22H21N3O4 — CID 23856693
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-pyridin-4-ylquinoline-4-carboxylate (PubChem CID 23856693) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-pyridin-4-ylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-pyridin-4-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 23856693 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-pyridin-4-ylquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccncc2)nc2ccccc12)NCC1CCCO1 |
| InChI | InChI=1S/C22H21N3O4/c26-21(24-13-16-4-3-11-28-16)14-29-22(27)18-12-20(15-7-9-23-10-8-15)25-19-6-2-1-5-17(18)19/h1-2,5-10,12,16H,3-4,11,13-14H2,(H,24,26) |
| InChIKey | AFKBYIMLXJZSHK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |