C17H18N2O5 — CID 2080081
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 2080081) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2080081 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)[nH]c2ccccc12)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H18N2O5/c20-15-8-13(12-5-1-2-6-14(12)19-15)17(22)24-10-16(21)18-9-11-4-3-7-23-11/h1-2,5-6,8,11H,3-4,7,9-10H2,(H,18,21)(H,19,20)/t11-/m0/s1 |
| InChIKey | KLNMUTNEBMADRU-NSHDSACASA-N |
| XLogP | 0.98 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |