C27H24N2O4 — CID 23767440
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-naphthalen-1-ylquinoline-4-carboxylate (PubChem CID 23767440) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-naphthalen-1-ylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-naphthalen-1-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 23767440 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-naphthalen-1-ylquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2cccc3ccccc23)nc2ccccc12)NCC1CCCO1 |
| InChI | InChI=1S/C27H24N2O4/c30-26(28-16-19-9-6-14-32-19)17-33-27(31)23-15-25(29-24-13-4-3-11-22(23)24)21-12-5-8-18-7-1-2-10-20(18)21/h1-5,7-8,10-13,15,19H,6,9,14,16-17H2,(H,28,30) |
| InChIKey | NHBNWYWTFZMVTA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |