C29H22N2O3 — CID 2335666
[2-(benzylamino)-2-oxoethyl] 2-naphthalen-1-ylquinoline-4-carboxylate (PubChem CID 2335666) has the molecular formula C29H22N2O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 2-naphthalen-1-ylquinoline-4-carboxylate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] 2-naphthalen-1-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2335666 |
| Molecular Formula | C29H22N2O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 2-naphthalen-1-ylquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2cccc3ccccc23)nc2ccccc12)NCc1ccccc1 |
| InChI | InChI=1S/C29H22N2O3/c32-28(30-18-20-9-2-1-3-10-20)19-34-29(33)25-17-27(31-26-16-7-6-14-24(25)26)23-15-8-12-21-11-4-5-13-22(21)23/h1-17H,18-19H2,(H,30,32) |
| InChIKey | OIBNUCZTCLIELB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |