C25H22N2O3 — CID 2569270
[2-oxo-2-(propan-2-ylamino)ethyl] 2-naphthalen-1-ylquinoline-4-carboxylate (PubChem CID 2569270) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylamino)ethyl] 2-naphthalen-1-ylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(propan-2-ylamino)ethyl] 2-naphthalen-1-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2569270 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [2-oxo-2-(propan-2-ylamino)ethyl] 2-naphthalen-1-ylquinoline-4-carboxylate |
| SMILES | CC(C)NC(=O)COC(=O)c1cc(-c2cccc3ccccc23)nc2ccccc12 |
| InChI | InChI=1S/C25H22N2O3/c1-16(2)26-24(28)15-30-25(29)21-14-23(27-22-13-6-5-11-20(21)22)19-12-7-9-17-8-3-4-10-18(17)19/h3-14,16H,15H2,1-2H3,(H,26,28) |
| InChIKey | UGHJUNUZKGCWEU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |