C29H21ClN2O3 — CID 23993753
[2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 2-naphthalen-1-ylquinoline-4-carboxylate (PubChem CID 23993753) has the molecular formula C29H21ClN2O3 and a molecular weight of 480.95 g/mol. Its IUPAC name is [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 2-naphthalen-1-ylquinoline-4-carboxylate.
| Compound Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 2-naphthalen-1-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 23993753 |
| Molecular Formula | C29H21ClN2O3 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] 2-naphthalen-1-ylquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2cccc3ccccc23)nc2ccccc12)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C29H21ClN2O3/c30-21-10-5-7-19(15-21)17-31-28(33)18-35-29(34)25-16-27(32-26-14-4-3-12-24(25)26)23-13-6-9-20-8-1-2-11-22(20)23/h1-16H,17-18H2,(H,31,33) |
| InChIKey | XEVYOIGAXWLBDD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |